C8H11NO4 — CID 19018226
2-(2,5-dioxopyrrolidin-1-yl)butanoic acid (PubChem CID 19018226) has the molecular formula C8H11NO4 and a molecular weight of 185.18 g/mol. Its IUPAC name is 2-(2,5-dioxopyrrolidin-1-yl)butanoic acid.
| Compound Name | 2-(2,5-dioxopyrrolidin-1-yl)butanoic acid |
|---|---|
| PubChem CID | 19018226 |
| Molecular Formula | C8H11NO4 |
| Molecular Weight | 185.18 g/mol |
| Exact Mass | 185.07 |
| IUPAC Name | 2-(2,5-dioxopyrrolidin-1-yl)butanoic acid |
| SMILES | CCC(C(=O)O)N1C(=O)CCC1=O |
| InChI | InChI=1S/C8H11NO4/c1-2-5(8(12)13)9-6(10)3-4-7(9)11/h5H,2-4H2,1H3,(H,12,13) |
| InChIKey | ZDNGLXCKYXBSRI-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.18 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|