2-(triazol-1-yl)acetic acid

C4H5N3O2 — CID 19018499

IUPAC2-(triazol-1-yl)acetic acid
SMILESO=C(O)Cn1ccnn1
InChIInChI=1S/C4H5N3O2/c8-4(9)3-7-2-1-5-6-7/h1-2H,3H2,(H,8,9)
InChIKeyYUHHBTFHHCASIC-UHFFFAOYSA-N
MW127.10 g/mol
LogP-0.64
Rot. Bonds2

About 2-(triazol-1-yl)acetic acid

2-(triazol-1-yl)acetic acid (PubChem CID 19018499) has the molecular formula C4H5N3O2 and a molecular weight of 127.10 g/mol. Its IUPAC name is 2-(triazol-1-yl)acetic acid.

Molecular Properties

Compound Name2-(triazol-1-yl)acetic acid
PubChem CID19018499
Molecular FormulaC4H5N3O2
Molecular Weight127.10 g/mol
Exact Mass127.04
IUPAC Name2-(triazol-1-yl)acetic acid
SMILESO=C(O)Cn1ccnn1
InChIInChI=1S/C4H5N3O2/c8-4(9)3-7-2-1-5-6-7/h1-2H,3H2,(H,8,9)
InChIKeyYUHHBTFHHCASIC-UHFFFAOYSA-N
XLogP-0.64
TPSA68.01 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms9
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500127.10
LogP ≤ 5-0.64
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-(triazol-1-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(triazol-1-yl)acetic acid?
The IUPAC name of 2-(triazol-1-yl)acetic acid (CID 19018499) is 2-(triazol-1-yl)acetic acid.
What is the SMILES notation for 2-(triazol-1-yl)acetic acid?
The canonical SMILES for 2-(triazol-1-yl)acetic acid is O=C(O)Cn1ccnn1.
What is the InChIKey of 2-(triazol-1-yl)acetic acid?
The InChIKey is YUHHBTFHHCASIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5N3O2/c8-4(9)3-7-2-1-5-6-7/h1-2H,3H2,(H,8,9).
What are the key properties of 2-(triazol-1-yl)acetic acid?
2-(triazol-1-yl)acetic acid has a molecular weight of 127.10 g/mol, XLogP of -0.64, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(triazol-1-yl)acetic acid is sourced from PubChem (CID 19018499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).