About 2-methyl-4-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-1,3-thiazole
2-methyl-4-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-1,3-thiazole (PubChem CID 19018552) has the molecular formula C10H14N2S
and a molecular weight of 194.30 g/mol. Its IUPAC name is 2-methyl-4-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-1,3-thiazole.
Molecular Properties
| Compound Name | 2-methyl-4-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-1,3-thiazole |
| PubChem CID | 19018552 |
| Molecular Formula | C10H14N2S |
| Molecular Weight | 194.30 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 2-methyl-4-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-1,3-thiazole |
| SMILES | Cc1nc(C2=CCCN(C)C2)cs1 |
| InChI | InChI=1S/C10H14N2S/c1-8-11-10(7-13-8)9-4-3-5-12(2)6-9/h4,7H,3,5-6H2,1-2H3 |
| InChIKey | MGYACJYJKNESME-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.30 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methyl-4-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-4-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-1,3-thiazole?
The IUPAC name of 2-methyl-4-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-1,3-thiazole (CID 19018552) is 2-methyl-4-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-1,3-thiazole.
What is the SMILES notation for 2-methyl-4-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-1,3-thiazole?
The canonical SMILES for 2-methyl-4-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-1,3-thiazole is Cc1nc(C2=CCCN(C)C2)cs1.
What is the InChIKey of 2-methyl-4-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-1,3-thiazole?
The InChIKey is MGYACJYJKNESME-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2S/c1-8-11-10(7-13-8)9-4-3-5-12(2)6-9/h4,7H,3,5-6H2,1-2H3.
What are the key properties of 2-methyl-4-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-1,3-thiazole?
2-methyl-4-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-1,3-thiazole has a molecular weight of 194.30 g/mol, XLogP of 2.17, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-1,3-thiazole is sourced from PubChem (CID 19018552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).