About 1-methylazepan-2-one;1,1,3,3-tetramethylurea
1-methylazepan-2-one;1,1,3,3-tetramethylurea (PubChem CID 19019034) has the molecular formula C12H25N3O2
and a molecular weight of 243.35 g/mol. Its IUPAC name is 1-methylazepan-2-one;1,1,3,3-tetramethylurea.
Molecular Properties
| Compound Name | 1-methylazepan-2-one;1,1,3,3-tetramethylurea |
| PubChem CID | 19019034 |
| Molecular Formula | C12H25N3O2 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.19 |
| IUPAC Name | 1-methylazepan-2-one;1,1,3,3-tetramethylurea |
| SMILES | CN(C)C(=O)N(C)C.CN1CCCCCC1=O |
| InChI | InChI=1S/C7H13NO.C5H12N2O/c1-8-6-4-2-3-5-7(8)9;1-6(2)5(8)7(3)4/h2-6H2,1H3;1-4H3 |
| InChIKey | SEVQWRZXWMZZRR-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-methylazepan-2-one;1,1,3,3-tetramethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylazepan-2-one;1,1,3,3-tetramethylurea?
The IUPAC name of 1-methylazepan-2-one;1,1,3,3-tetramethylurea (CID 19019034) is 1-methylazepan-2-one;1,1,3,3-tetramethylurea.
What is the SMILES notation for 1-methylazepan-2-one;1,1,3,3-tetramethylurea?
The canonical SMILES for 1-methylazepan-2-one;1,1,3,3-tetramethylurea is CN(C)C(=O)N(C)C.CN1CCCCCC1=O.
What is the InChIKey of 1-methylazepan-2-one;1,1,3,3-tetramethylurea?
The InChIKey is SEVQWRZXWMZZRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO.C5H12N2O/c1-8-6-4-2-3-5-7(8)9;1-6(2)5(8)7(3)4/h2-6H2,1H3;1-4H3.
What are the key properties of 1-methylazepan-2-one;1,1,3,3-tetramethylurea?
1-methylazepan-2-one;1,1,3,3-tetramethylurea has a molecular weight of 243.35 g/mol, XLogP of 1.25, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylazepan-2-one;1,1,3,3-tetramethylurea is sourced from PubChem (CID 19019034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).