C26H24FN5O2 — CID 19019326
1-[10-(2-fluorophenyl)-4-methyl-13-oxo-1,4,11-triazatricyclo[7.4.1.05,14]tetradeca-5,7,9(14),10-tetraen-12-yl]-3-(3-methylphenyl)urea (PubChem CID 19019326) has the molecular formula C26H24FN5O2 and a molecular weight of 457.51 g/mol. Its IUPAC name is 1-[10-(2-fluorophenyl)-4-methyl-13-oxo-1,4,11-triazatricyclo[7.4.1.05,14]tetradeca-5,7,9(14),10-tetraen-12-yl]-3-(3-methylphenyl)urea.
| Compound Name | 1-[10-(2-fluorophenyl)-4-methyl-13-oxo-1,4,11-triazatricyclo[7.4.1.05,14]tetradeca-5,7,9(14),10-tetraen-12-yl]-3-(3-methylphenyl)urea |
|---|---|
| PubChem CID | 19019326 |
| Molecular Formula | C26H24FN5O2 |
| Molecular Weight | 457.51 g/mol |
| Exact Mass | 457.19 |
| IUPAC Name | 1-[10-(2-fluorophenyl)-4-methyl-13-oxo-1,4,11-triazatricyclo[7.4.1.05,14]tetradeca-5,7,9(14),10-tetraen-12-yl]-3-(3-methylphenyl)urea |
| SMILES | Cc1cccc(NC(=O)NC2N=C(c3ccccc3F)c3cccc4c3N(CCN4C)C2=O)c1 |
| InChI | InChI=1S/C26H24FN5O2/c1-16-7-5-8-17(15-16)28-26(34)30-24-25(33)32-14-13-31(2)21-12-6-10-19(23(21)32)22(29-24)18-9-3-4-11-20(18)27/h3-12,15,24H,13-14H2,1-2H3,(H2,28,30,34) |
| InChIKey | BIDDLAPFIYGNCG-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.51 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |