About 7-[(5-fluoro-1,3-benzothiazol-2-yl)methoxy]naphthalen-2-ol
7-[(5-fluoro-1,3-benzothiazol-2-yl)methoxy]naphthalen-2-ol (PubChem CID 19019454) has the molecular formula C18H12FNO2S
and a molecular weight of 325.36 g/mol. Its IUPAC name is 7-[(5-fluoro-1,3-benzothiazol-2-yl)methoxy]naphthalen-2-ol.
Molecular Properties
| Compound Name | 7-[(5-fluoro-1,3-benzothiazol-2-yl)methoxy]naphthalen-2-ol |
| PubChem CID | 19019454 |
| Molecular Formula | C18H12FNO2S |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | 7-[(5-fluoro-1,3-benzothiazol-2-yl)methoxy]naphthalen-2-ol |
| SMILES | Oc1ccc2ccc(OCc3nc4cc(F)ccc4s3)cc2c1 |
| InChI | InChI=1S/C18H12FNO2S/c19-13-3-6-17-16(9-13)20-18(23-17)10-22-15-5-2-11-1-4-14(21)7-12(11)8-15/h1-9,21H,10H2 |
| InChIKey | SPTHHTCWHJDXJR-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-[(5-fluoro-1,3-benzothiazol-2-yl)methoxy]naphthalen-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[(5-fluoro-1,3-benzothiazol-2-yl)methoxy]naphthalen-2-ol?
The IUPAC name of 7-[(5-fluoro-1,3-benzothiazol-2-yl)methoxy]naphthalen-2-ol (CID 19019454) is 7-[(5-fluoro-1,3-benzothiazol-2-yl)methoxy]naphthalen-2-ol.
What is the SMILES notation for 7-[(5-fluoro-1,3-benzothiazol-2-yl)methoxy]naphthalen-2-ol?
The canonical SMILES for 7-[(5-fluoro-1,3-benzothiazol-2-yl)methoxy]naphthalen-2-ol is Oc1ccc2ccc(OCc3nc4cc(F)ccc4s3)cc2c1.
What is the InChIKey of 7-[(5-fluoro-1,3-benzothiazol-2-yl)methoxy]naphthalen-2-ol?
The InChIKey is SPTHHTCWHJDXJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12FNO2S/c19-13-3-6-17-16(9-13)20-18(23-17)10-22-15-5-2-11-1-4-14(21)7-12(11)8-15/h1-9,21H,10H2.
What are the key properties of 7-[(5-fluoro-1,3-benzothiazol-2-yl)methoxy]naphthalen-2-ol?
7-[(5-fluoro-1,3-benzothiazol-2-yl)methoxy]naphthalen-2-ol has a molecular weight of 325.36 g/mol, XLogP of 4.87, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[(5-fluoro-1,3-benzothiazol-2-yl)methoxy]naphthalen-2-ol is sourced from PubChem (CID 19019454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).