About 6-[1-(5-fluoro-1,3-benzothiazol-2-yl)ethenyl]-2,3-dihydrochromen-4-one
6-[1-(5-fluoro-1,3-benzothiazol-2-yl)ethenyl]-2,3-dihydrochromen-4-one (PubChem CID 19019514) has the molecular formula C18H12FNO2S
and a molecular weight of 325.36 g/mol. Its IUPAC name is 6-[1-(5-fluoro-1,3-benzothiazol-2-yl)ethenyl]-2,3-dihydrochromen-4-one.
Molecular Properties
| Compound Name | 6-[1-(5-fluoro-1,3-benzothiazol-2-yl)ethenyl]-2,3-dihydrochromen-4-one |
| PubChem CID | 19019514 |
| Molecular Formula | C18H12FNO2S |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | 6-[1-(5-fluoro-1,3-benzothiazol-2-yl)ethenyl]-2,3-dihydrochromen-4-one |
| SMILES | C=C(c1ccc2c(c1)C(=O)CCO2)c1nc2cc(F)ccc2s1 |
| InChI | InChI=1S/C18H12FNO2S/c1-10(18-20-14-9-12(19)3-5-17(14)23-18)11-2-4-16-13(8-11)15(21)6-7-22-16/h2-5,8-9H,1,6-7H2 |
| InChIKey | IXSCSQMWMFIRMV-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-[1-(5-fluoro-1,3-benzothiazol-2-yl)ethenyl]-2,3-dihydrochromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[1-(5-fluoro-1,3-benzothiazol-2-yl)ethenyl]-2,3-dihydrochromen-4-one?
The IUPAC name of 6-[1-(5-fluoro-1,3-benzothiazol-2-yl)ethenyl]-2,3-dihydrochromen-4-one (CID 19019514) is 6-[1-(5-fluoro-1,3-benzothiazol-2-yl)ethenyl]-2,3-dihydrochromen-4-one.
What is the SMILES notation for 6-[1-(5-fluoro-1,3-benzothiazol-2-yl)ethenyl]-2,3-dihydrochromen-4-one?
The canonical SMILES for 6-[1-(5-fluoro-1,3-benzothiazol-2-yl)ethenyl]-2,3-dihydrochromen-4-one is C=C(c1ccc2c(c1)C(=O)CCO2)c1nc2cc(F)ccc2s1.
What is the InChIKey of 6-[1-(5-fluoro-1,3-benzothiazol-2-yl)ethenyl]-2,3-dihydrochromen-4-one?
The InChIKey is IXSCSQMWMFIRMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12FNO2S/c1-10(18-20-14-9-12(19)3-5-17(14)23-18)11-2-4-16-13(8-11)15(21)6-7-22-16/h2-5,8-9H,1,6-7H2.
What are the key properties of 6-[1-(5-fluoro-1,3-benzothiazol-2-yl)ethenyl]-2,3-dihydrochromen-4-one?
6-[1-(5-fluoro-1,3-benzothiazol-2-yl)ethenyl]-2,3-dihydrochromen-4-one has a molecular weight of 325.36 g/mol, XLogP of 4.46, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[1-(5-fluoro-1,3-benzothiazol-2-yl)ethenyl]-2,3-dihydrochromen-4-one is sourced from PubChem (CID 19019514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).