About (1E)-1-[amino-[(3,4-dichlorophenyl)methoxyamino]methylidene]-2-propan-2-ylguanidine
(1E)-1-[amino-[(3,4-dichlorophenyl)methoxyamino]methylidene]-2-propan-2-ylguanidine (PubChem CID 19019600) has the molecular formula C12H17Cl2N5O
and a molecular weight of 318.21 g/mol. Its IUPAC name is (1E)-1-[amino-[(3,4-dichlorophenyl)methoxyamino]methylidene]-2-propan-2-ylguanidine.
Molecular Properties
| Compound Name | (1E)-1-[amino-[(3,4-dichlorophenyl)methoxyamino]methylidene]-2-propan-2-ylguanidine |
| PubChem CID | 19019600 |
| Molecular Formula | C12H17Cl2N5O |
| Molecular Weight | 318.21 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | (1E)-1-[amino-[(3,4-dichlorophenyl)methoxyamino]methylidene]-2-propan-2-ylguanidine |
| SMILES | CC(C)/N=C(N)/N=C(\N)NOCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H17Cl2N5O/c1-7(2)17-11(15)18-12(16)19-20-6-8-3-4-9(13)10(14)5-8/h3-5,7H,6H2,1-2H3,(H5,15,16,17,18,19) |
| InChIKey | UKFXELFOOVFACC-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 98.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.21 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (1E)-1-[amino-[(3,4-dichlorophenyl)methoxyamino]methylidene]-2-propan-2-ylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1E)-1-[amino-[(3,4-dichlorophenyl)methoxyamino]methylidene]-2-propan-2-ylguanidine?
The IUPAC name of (1E)-1-[amino-[(3,4-dichlorophenyl)methoxyamino]methylidene]-2-propan-2-ylguanidine (CID 19019600) is (1E)-1-[amino-[(3,4-dichlorophenyl)methoxyamino]methylidene]-2-propan-2-ylguanidine.
What is the SMILES notation for (1E)-1-[amino-[(3,4-dichlorophenyl)methoxyamino]methylidene]-2-propan-2-ylguanidine?
The canonical SMILES for (1E)-1-[amino-[(3,4-dichlorophenyl)methoxyamino]methylidene]-2-propan-2-ylguanidine is CC(C)/N=C(N)/N=C(\N)NOCc1ccc(Cl)c(Cl)c1.
What is the InChIKey of (1E)-1-[amino-[(3,4-dichlorophenyl)methoxyamino]methylidene]-2-propan-2-ylguanidine?
The InChIKey is UKFXELFOOVFACC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17Cl2N5O/c1-7(2)17-11(15)18-12(16)19-20-6-8-3-4-9(13)10(14)5-8/h3-5,7H,6H2,1-2H3,(H5,15,16,17,18,19).
What are the key properties of (1E)-1-[amino-[(3,4-dichlorophenyl)methoxyamino]methylidene]-2-propan-2-ylguanidine?
(1E)-1-[amino-[(3,4-dichlorophenyl)methoxyamino]methylidene]-2-propan-2-ylguanidine has a molecular weight of 318.21 g/mol, XLogP of 2.05, 4 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1E)-1-[amino-[(3,4-dichlorophenyl)methoxyamino]methylidene]-2-propan-2-ylguanidine is sourced from PubChem (CID 19019600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).