C11H21N3 — CID 19019654
2-(4-methylpiperazin-1-yl)-2,3,4,7-tetrahydro-1H-azepine (PubChem CID 19019654) has the molecular formula C11H21N3 and a molecular weight of 195.31 g/mol. Its IUPAC name is 2-(4-methylpiperazin-1-yl)-2,3,4,7-tetrahydro-1H-azepine.
| Compound Name | 2-(4-methylpiperazin-1-yl)-2,3,4,7-tetrahydro-1H-azepine |
|---|---|
| PubChem CID | 19019654 |
| Molecular Formula | C11H21N3 |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.17 |
| IUPAC Name | 2-(4-methylpiperazin-1-yl)-2,3,4,7-tetrahydro-1H-azepine |
| SMILES | CN1CCN(C2CCC=CCN2)CC1 |
| InChI | InChI=1S/C11H21N3/c1-13-7-9-14(10-8-13)11-5-3-2-4-6-12-11/h2,4,11-12H,3,5-10H2,1H3 |
| InChIKey | RNHWIZIBCABOCO-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|