About dimethyl 4,5-dichloro-4-fluorocyclohexene-1,2-dicarboxylate
dimethyl 4,5-dichloro-4-fluorocyclohexene-1,2-dicarboxylate (PubChem CID 19019911) has the molecular formula C10H11Cl2FO4
and a molecular weight of 285.10 g/mol. Its IUPAC name is dimethyl 4,5-dichloro-4-fluorocyclohexene-1,2-dicarboxylate.
Molecular Properties
| Compound Name | dimethyl 4,5-dichloro-4-fluorocyclohexene-1,2-dicarboxylate |
| PubChem CID | 19019911 |
| Molecular Formula | C10H11Cl2FO4 |
| Molecular Weight | 285.10 g/mol |
| Exact Mass | 284.00 |
| IUPAC Name | dimethyl 4,5-dichloro-4-fluorocyclohexene-1,2-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)CC(F)(Cl)C(Cl)C1 |
| InChI | InChI=1S/C10H11Cl2FO4/c1-16-8(14)5-3-7(11)10(12,13)4-6(5)9(15)17-2/h7H,3-4H2,1-2H3 |
| InChIKey | QZWPKOQRVFOXHU-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.10 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze dimethyl 4,5-dichloro-4-fluorocyclohexene-1,2-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 4,5-dichloro-4-fluorocyclohexene-1,2-dicarboxylate?
The IUPAC name of dimethyl 4,5-dichloro-4-fluorocyclohexene-1,2-dicarboxylate (CID 19019911) is dimethyl 4,5-dichloro-4-fluorocyclohexene-1,2-dicarboxylate.
What is the SMILES notation for dimethyl 4,5-dichloro-4-fluorocyclohexene-1,2-dicarboxylate?
The canonical SMILES for dimethyl 4,5-dichloro-4-fluorocyclohexene-1,2-dicarboxylate is COC(=O)C1=C(C(=O)OC)CC(F)(Cl)C(Cl)C1.
What is the InChIKey of dimethyl 4,5-dichloro-4-fluorocyclohexene-1,2-dicarboxylate?
The InChIKey is QZWPKOQRVFOXHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11Cl2FO4/c1-16-8(14)5-3-7(11)10(12,13)4-6(5)9(15)17-2/h7H,3-4H2,1-2H3.
What are the key properties of dimethyl 4,5-dichloro-4-fluorocyclohexene-1,2-dicarboxylate?
dimethyl 4,5-dichloro-4-fluorocyclohexene-1,2-dicarboxylate has a molecular weight of 285.10 g/mol, XLogP of 1.93, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 4,5-dichloro-4-fluorocyclohexene-1,2-dicarboxylate is sourced from PubChem (CID 19019911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).