About 4-bromo-5-fluorocyclohexene-1,2-dicarboxylic acid
4-bromo-5-fluorocyclohexene-1,2-dicarboxylic acid (PubChem CID 19019914) has the molecular formula C8H8BrFO4
and a molecular weight of 267.05 g/mol. Its IUPAC name is 4-bromo-5-fluorocyclohexene-1,2-dicarboxylic acid.
Molecular Properties
| Compound Name | 4-bromo-5-fluorocyclohexene-1,2-dicarboxylic acid |
| PubChem CID | 19019914 |
| Molecular Formula | C8H8BrFO4 |
| Molecular Weight | 267.05 g/mol |
| Exact Mass | 265.96 |
| IUPAC Name | 4-bromo-5-fluorocyclohexene-1,2-dicarboxylic acid |
| SMILES | O=C(O)C1=C(C(=O)O)CC(Br)C(F)C1 |
| InChI | InChI=1S/C8H8BrFO4/c9-5-1-3(7(11)12)4(8(13)14)2-6(5)10/h5-6H,1-2H2,(H,11,12)(H,13,14) |
| InChIKey | NRTHIRVRIHCKEB-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.05 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-5-fluorocyclohexene-1,2-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-5-fluorocyclohexene-1,2-dicarboxylic acid?
The IUPAC name of 4-bromo-5-fluorocyclohexene-1,2-dicarboxylic acid (CID 19019914) is 4-bromo-5-fluorocyclohexene-1,2-dicarboxylic acid.
What is the SMILES notation for 4-bromo-5-fluorocyclohexene-1,2-dicarboxylic acid?
The canonical SMILES for 4-bromo-5-fluorocyclohexene-1,2-dicarboxylic acid is O=C(O)C1=C(C(=O)O)CC(Br)C(F)C1.
What is the InChIKey of 4-bromo-5-fluorocyclohexene-1,2-dicarboxylic acid?
The InChIKey is NRTHIRVRIHCKEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8BrFO4/c9-5-1-3(7(11)12)4(8(13)14)2-6(5)10/h5-6H,1-2H2,(H,11,12)(H,13,14).
What are the key properties of 4-bromo-5-fluorocyclohexene-1,2-dicarboxylic acid?
4-bromo-5-fluorocyclohexene-1,2-dicarboxylic acid has a molecular weight of 267.05 g/mol, XLogP of 1.35, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-5-fluorocyclohexene-1,2-dicarboxylic acid is sourced from PubChem (CID 19019914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).