About 4-ethoxybutanamide
4-ethoxybutanamide (PubChem CID 19020272) has the molecular formula C6H13NO2
and a molecular weight of 131.18 g/mol. Its IUPAC name is 4-ethoxybutanamide.
Molecular Properties
| Compound Name | 4-ethoxybutanamide |
| PubChem CID | 19020272 |
| Molecular Formula | C6H13NO2 |
| Molecular Weight | 131.18 g/mol |
| Exact Mass | 131.09 |
| IUPAC Name | 4-ethoxybutanamide |
| SMILES | CCOCCCC(N)=O |
| InChI | InChI=1S/C6H13NO2/c1-2-9-5-3-4-6(7)8/h2-5H2,1H3,(H2,7,8) |
| InChIKey | BVLOWVKWYYSFEX-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.18 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-ethoxybutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethoxybutanamide?
The IUPAC name of 4-ethoxybutanamide (CID 19020272) is 4-ethoxybutanamide.
What is the SMILES notation for 4-ethoxybutanamide?
The canonical SMILES for 4-ethoxybutanamide is CCOCCCC(N)=O.
What is the InChIKey of 4-ethoxybutanamide?
The InChIKey is BVLOWVKWYYSFEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NO2/c1-2-9-5-3-4-6(7)8/h2-5H2,1H3,(H2,7,8).
What are the key properties of 4-ethoxybutanamide?
4-ethoxybutanamide has a molecular weight of 131.18 g/mol, XLogP of 0.29, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethoxybutanamide is sourced from PubChem (CID 19020272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).