C27H29F3N2O2 — CID 19021184
[4-(5-nonylpyrimidin-2-yl)phenyl] 4-(trifluoromethyl)benzoate (PubChem CID 19021184) has the molecular formula C27H29F3N2O2 and a molecular weight of 470.54 g/mol. Its IUPAC name is [4-(5-nonylpyrimidin-2-yl)phenyl] 4-(trifluoromethyl)benzoate.
| Compound Name | [4-(5-nonylpyrimidin-2-yl)phenyl] 4-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 19021184 |
| Molecular Formula | C27H29F3N2O2 |
| Molecular Weight | 470.54 g/mol |
| Exact Mass | 470.22 |
| IUPAC Name | [4-(5-nonylpyrimidin-2-yl)phenyl] 4-(trifluoromethyl)benzoate |
| SMILES | CCCCCCCCCc1cnc(-c2ccc(OC(=O)c3ccc(C(F)(F)F)cc3)cc2)nc1 |
| InChI | InChI=1S/C27H29F3N2O2/c1-2-3-4-5-6-7-8-9-20-18-31-25(32-19-20)21-12-16-24(17-13-21)34-26(33)22-10-14-23(15-11-22)27(28,29)30/h10-19H,2-9H2,1H3 |
| InChIKey | TYXUNADPTHGNAO-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.54 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|