C14H28N4O2 — CID 19021276
4-hydrazinyl-2-methyl-4-oxo-N-(2,2,6,6-tetramethylpiperidin-3-yl)butanamide (PubChem CID 19021276) has the molecular formula C14H28N4O2 and a molecular weight of 284.40 g/mol. Its IUPAC name is 4-hydrazinyl-2-methyl-4-oxo-N-(2,2,6,6-tetramethylpiperidin-3-yl)butanamide.
| Compound Name | 4-hydrazinyl-2-methyl-4-oxo-N-(2,2,6,6-tetramethylpiperidin-3-yl)butanamide |
|---|---|
| PubChem CID | 19021276 |
| Molecular Formula | C14H28N4O2 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.22 |
| IUPAC Name | 4-hydrazinyl-2-methyl-4-oxo-N-(2,2,6,6-tetramethylpiperidin-3-yl)butanamide |
| SMILES | CC(CC(=O)NN)C(=O)NC1CCC(C)(C)NC1(C)C |
| InChI | InChI=1S/C14H28N4O2/c1-9(8-11(19)17-15)12(20)16-10-6-7-13(2,3)18-14(10,4)5/h9-10,18H,6-8,15H2,1-5H3,(H,16,20)(H,17,19) |
| InChIKey | QDKKZZAROCZXJO-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|