About triazole-1,5-diamine
triazole-1,5-diamine (PubChem CID 19021718) has the molecular formula C2H5N5
and a molecular weight of 99.10 g/mol. Its IUPAC name is triazole-1,5-diamine.
Molecular Properties
| Compound Name | triazole-1,5-diamine |
| PubChem CID | 19021718 |
| Molecular Formula | C2H5N5 |
| Molecular Weight | 99.10 g/mol |
| Exact Mass | 99.05 |
| IUPAC Name | triazole-1,5-diamine |
| SMILES | Nc1cnnn1N |
| InChI | InChI=1S/C2H5N5/c3-2-1-5-6-7(2)4/h1H,3-4H2 |
| InChIKey | GRVBADTYFYKTKT-UHFFFAOYSA-N |
| XLogP | -1.43 |
| TPSA | 82.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 99.10 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze triazole-1,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triazole-1,5-diamine?
The IUPAC name of triazole-1,5-diamine (CID 19021718) is triazole-1,5-diamine.
What is the SMILES notation for triazole-1,5-diamine?
The canonical SMILES for triazole-1,5-diamine is Nc1cnnn1N.
What is the InChIKey of triazole-1,5-diamine?
The InChIKey is GRVBADTYFYKTKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H5N5/c3-2-1-5-6-7(2)4/h1H,3-4H2.
What are the key properties of triazole-1,5-diamine?
triazole-1,5-diamine has a molecular weight of 99.10 g/mol, XLogP of -1.43, 0 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for triazole-1,5-diamine is sourced from PubChem (CID 19021718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).