About 1-[[2-(6-bromohexyl)-4,5-diphenylimidazol-1-yl]methoxy]ethyl-trimethylsilane
1-[[2-(6-bromohexyl)-4,5-diphenylimidazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 19021754) has the molecular formula C27H37BrN2OSi
and a molecular weight of 513.60 g/mol. Its IUPAC name is 1-[[2-(6-bromohexyl)-4,5-diphenylimidazol-1-yl]methoxy]ethyl-trimethylsilane.
Molecular Properties
| Compound Name | 1-[[2-(6-bromohexyl)-4,5-diphenylimidazol-1-yl]methoxy]ethyl-trimethylsilane |
| PubChem CID | 19021754 |
| Molecular Formula | C27H37BrN2OSi |
| Molecular Weight | 513.60 g/mol |
| Exact Mass | 512.19 |
| IUPAC Name | 1-[[2-(6-bromohexyl)-4,5-diphenylimidazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | CC(OCn1c(CCCCCCBr)nc(-c2ccccc2)c1-c1ccccc1)[Si](C)(C)C |
| InChI | InChI=1S/C27H37BrN2OSi/c1-22(32(2,3)4)31-21-30-25(19-13-5-6-14-20-28)29-26(23-15-9-7-10-16-23)27(30)24-17-11-8-12-18-24/h7-12,15-18,22H,5-6,13-14,19-21H2,1-4H3 |
| InChIKey | JYDOMXXWQDDIDY-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 513.60 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-[[2-(6-bromohexyl)-4,5-diphenylimidazol-1-yl]methoxy]ethyl-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[2-(6-bromohexyl)-4,5-diphenylimidazol-1-yl]methoxy]ethyl-trimethylsilane?
The IUPAC name of 1-[[2-(6-bromohexyl)-4,5-diphenylimidazol-1-yl]methoxy]ethyl-trimethylsilane (CID 19021754) is 1-[[2-(6-bromohexyl)-4,5-diphenylimidazol-1-yl]methoxy]ethyl-trimethylsilane.
What is the SMILES notation for 1-[[2-(6-bromohexyl)-4,5-diphenylimidazol-1-yl]methoxy]ethyl-trimethylsilane?
The canonical SMILES for 1-[[2-(6-bromohexyl)-4,5-diphenylimidazol-1-yl]methoxy]ethyl-trimethylsilane is CC(OCn1c(CCCCCCBr)nc(-c2ccccc2)c1-c1ccccc1)[Si](C)(C)C.
What is the InChIKey of 1-[[2-(6-bromohexyl)-4,5-diphenylimidazol-1-yl]methoxy]ethyl-trimethylsilane?
The InChIKey is JYDOMXXWQDDIDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H37BrN2OSi/c1-22(32(2,3)4)31-21-30-25(19-13-5-6-14-20-28)29-26(23-15-9-7-10-16-23)27(30)24-17-11-8-12-18-24/h7-12,15-18,22H,5-6,13-14,19-21H2,1-4H3.
What are the key properties of 1-[[2-(6-bromohexyl)-4,5-diphenylimidazol-1-yl]methoxy]ethyl-trimethylsilane?
1-[[2-(6-bromohexyl)-4,5-diphenylimidazol-1-yl]methoxy]ethyl-trimethylsilane has a molecular weight of 513.60 g/mol, XLogP of 7.95, 12 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[2-(6-bromohexyl)-4,5-diphenylimidazol-1-yl]methoxy]ethyl-trimethylsilane is sourced from PubChem (CID 19021754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).