About CID 19021835
CID 19021835 (PubChem CID 19021835) has the molecular formula C6H7O2Si
and a molecular weight of 139.21 g/mol.
Molecular Properties
| Compound Name | CID 19021835 |
| PubChem CID | 19021835 |
| Molecular Formula | C6H7O2Si |
| Molecular Weight | 139.21 g/mol |
| Exact Mass | 139.02 |
| IUPAC Name | — |
| SMILES | O=C1CCCC=C1O[Si] |
| InChI | InChI=1S/C6H7O2Si/c7-5-3-1-2-4-6(5)8-9/h4H,1-3H2 |
| InChIKey | SGYTVIHSBFCNQI-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.21 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 19021835 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 19021835?
The IUPAC name of CID 19021835 (CID 19021835) is not available.
What is the SMILES notation for CID 19021835?
The canonical SMILES for CID 19021835 is O=C1CCCC=C1O[Si].
What is the InChIKey of CID 19021835?
The InChIKey is SGYTVIHSBFCNQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7O2Si/c7-5-3-1-2-4-6(5)8-9/h4H,1-3H2.
What are the key properties of CID 19021835?
CID 19021835 has a molecular weight of 139.21 g/mol, XLogP of 0.72, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 19021835 is sourced from PubChem (CID 19021835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).