C7H13N3 — CID 19021947
2,6,7,8,9,9a-hexahydro-1H-pyrimido[1,2-a]pyrimidine (PubChem CID 19021947) has the molecular formula C7H13N3 and a molecular weight of 139.20 g/mol. Its IUPAC name is 2,6,7,8,9,9a-hexahydro-1H-pyrimido[1,2-a]pyrimidine.
| Compound Name | 2,6,7,8,9,9a-hexahydro-1H-pyrimido[1,2-a]pyrimidine |
|---|---|
| PubChem CID | 19021947 |
| Molecular Formula | C7H13N3 |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.11 |
| IUPAC Name | 2,6,7,8,9,9a-hexahydro-1H-pyrimido[1,2-a]pyrimidine |
| SMILES | C1=CN2CCCNC2NC1 |
| InChI | InChI=1S/C7H13N3/c1-3-8-7-9-4-2-6-10(7)5-1/h1,5,7-9H,2-4,6H2 |
| InChIKey | FBMGEATYKZTFMA-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |