About 2-isocyanatopentane
2-isocyanatopentane (PubChem CID 19022275) has the molecular formula C6H11NO
and a molecular weight of 113.16 g/mol. Its IUPAC name is 2-isocyanatopentane.
Molecular Properties
| Compound Name | 2-isocyanatopentane |
| PubChem CID | 19022275 |
| Molecular Formula | C6H11NO |
| Molecular Weight | 113.16 g/mol |
| Exact Mass | 113.08 |
| IUPAC Name | 2-isocyanatopentane |
| SMILES | CCCC(C)N=C=O |
| InChI | InChI=1S/C6H11NO/c1-3-4-6(2)7-5-8/h6H,3-4H2,1-2H3 |
| InChIKey | HOSRHDUJWMTWRD-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.16 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 2-isocyanatopentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-isocyanatopentane?
The IUPAC name of 2-isocyanatopentane (CID 19022275) is 2-isocyanatopentane.
What is the SMILES notation for 2-isocyanatopentane?
The canonical SMILES for 2-isocyanatopentane is CCCC(C)N=C=O.
What is the InChIKey of 2-isocyanatopentane?
The InChIKey is HOSRHDUJWMTWRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO/c1-3-4-6(2)7-5-8/h6H,3-4H2,1-2H3.
What are the key properties of 2-isocyanatopentane?
2-isocyanatopentane has a molecular weight of 113.16 g/mol, XLogP of 1.51, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-isocyanatopentane is sourced from PubChem (CID 19022275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).