About 2,2-dimethyl-5-methylsulfanyl-1,3-benzodioxole
2,2-dimethyl-5-methylsulfanyl-1,3-benzodioxole (PubChem CID 19022409) has the molecular formula C10H12O2S
and a molecular weight of 196.27 g/mol. Its IUPAC name is 2,2-dimethyl-5-methylsulfanyl-1,3-benzodioxole.
Molecular Properties
| Compound Name | 2,2-dimethyl-5-methylsulfanyl-1,3-benzodioxole |
| PubChem CID | 19022409 |
| Molecular Formula | C10H12O2S |
| Molecular Weight | 196.27 g/mol |
| Exact Mass | 196.06 |
| IUPAC Name | 2,2-dimethyl-5-methylsulfanyl-1,3-benzodioxole |
| SMILES | CSc1ccc2c(c1)OC(C)(C)O2 |
| InChI | InChI=1S/C10H12O2S/c1-10(2)11-8-5-4-7(13-3)6-9(8)12-10/h4-6H,1-3H3 |
| InChIKey | RARBEEPFNXYAGR-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.27 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,2-dimethyl-5-methylsulfanyl-1,3-benzodioxole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyl-5-methylsulfanyl-1,3-benzodioxole?
The IUPAC name of 2,2-dimethyl-5-methylsulfanyl-1,3-benzodioxole (CID 19022409) is 2,2-dimethyl-5-methylsulfanyl-1,3-benzodioxole.
What is the SMILES notation for 2,2-dimethyl-5-methylsulfanyl-1,3-benzodioxole?
The canonical SMILES for 2,2-dimethyl-5-methylsulfanyl-1,3-benzodioxole is CSc1ccc2c(c1)OC(C)(C)O2.
What is the InChIKey of 2,2-dimethyl-5-methylsulfanyl-1,3-benzodioxole?
The InChIKey is RARBEEPFNXYAGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O2S/c1-10(2)11-8-5-4-7(13-3)6-9(8)12-10/h4-6H,1-3H3.
What are the key properties of 2,2-dimethyl-5-methylsulfanyl-1,3-benzodioxole?
2,2-dimethyl-5-methylsulfanyl-1,3-benzodioxole has a molecular weight of 196.27 g/mol, XLogP of 2.92, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-5-methylsulfanyl-1,3-benzodioxole is sourced from PubChem (CID 19022409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).