About 7-methyl-1H-pyrazolo[1,5-a]pyrimidine-5-thione
7-methyl-1H-pyrazolo[1,5-a]pyrimidine-5-thione (PubChem CID 19022437) has the molecular formula C7H7N3S
and a molecular weight of 165.22 g/mol. Its IUPAC name is 7-methyl-1H-pyrazolo[1,5-a]pyrimidine-5-thione.
Molecular Properties
| Compound Name | 7-methyl-1H-pyrazolo[1,5-a]pyrimidine-5-thione |
| PubChem CID | 19022437 |
| Molecular Formula | C7H7N3S |
| Molecular Weight | 165.22 g/mol |
| Exact Mass | 165.04 |
| IUPAC Name | 7-methyl-1H-pyrazolo[1,5-a]pyrimidine-5-thione |
| SMILES | Cc1cc(=S)nc2cc[nH]n12 |
| InChI | InChI=1S/C7H7N3S/c1-5-4-7(11)9-6-2-3-8-10(5)6/h2-4,8H,1H3 |
| InChIKey | ZCHUJNBTXBNGGC-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.22 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 7-methyl-1H-pyrazolo[1,5-a]pyrimidine-5-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-1H-pyrazolo[1,5-a]pyrimidine-5-thione?
The IUPAC name of 7-methyl-1H-pyrazolo[1,5-a]pyrimidine-5-thione (CID 19022437) is 7-methyl-1H-pyrazolo[1,5-a]pyrimidine-5-thione.
What is the SMILES notation for 7-methyl-1H-pyrazolo[1,5-a]pyrimidine-5-thione?
The canonical SMILES for 7-methyl-1H-pyrazolo[1,5-a]pyrimidine-5-thione is Cc1cc(=S)nc2cc[nH]n12.
What is the InChIKey of 7-methyl-1H-pyrazolo[1,5-a]pyrimidine-5-thione?
The InChIKey is ZCHUJNBTXBNGGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3S/c1-5-4-7(11)9-6-2-3-8-10(5)6/h2-4,8H,1H3.
What are the key properties of 7-methyl-1H-pyrazolo[1,5-a]pyrimidine-5-thione?
7-methyl-1H-pyrazolo[1,5-a]pyrimidine-5-thione has a molecular weight of 165.22 g/mol, XLogP of 1.70, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-1H-pyrazolo[1,5-a]pyrimidine-5-thione is sourced from PubChem (CID 19022437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).