C9H6Cl2N4O2S — CID 19022516
4,6-dichloro-N-(4-sulfonylcyclohexa-1,5-dien-1-yl)-1,3,5-triazin-2-amine (PubChem CID 19022516) has the molecular formula C9H6Cl2N4O2S and a molecular weight of 305.15 g/mol. Its IUPAC name is 4,6-dichloro-N-(4-sulfonylcyclohexa-1,5-dien-1-yl)-1,3,5-triazin-2-amine.
| Compound Name | 4,6-dichloro-N-(4-sulfonylcyclohexa-1,5-dien-1-yl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 19022516 |
| Molecular Formula | C9H6Cl2N4O2S |
| Molecular Weight | 305.15 g/mol |
| Exact Mass | 303.96 |
| IUPAC Name | 4,6-dichloro-N-(4-sulfonylcyclohexa-1,5-dien-1-yl)-1,3,5-triazin-2-amine |
| SMILES | O=S(=O)=C1C=CC(Nc2nc(Cl)nc(Cl)n2)=CC1 |
| InChI | InChI=1S/C9H6Cl2N4O2S/c10-7-13-8(11)15-9(14-7)12-5-1-3-6(4-2-5)18(16)17/h1-3H,4H2,(H,12,13,14,15) |
| InChIKey | WXHHSHQVZBQUNR-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.15 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|