About [2-(4-methoxyphenyl)-4-oxo-3,5-dihydro-2H-1,5-benzothiazepin-3-yl] methanesulfonate
[2-(4-methoxyphenyl)-4-oxo-3,5-dihydro-2H-1,5-benzothiazepin-3-yl] methanesulfonate (PubChem CID 19022662) has the molecular formula C17H17NO5S2
and a molecular weight of 379.46 g/mol. Its IUPAC name is [2-(4-methoxyphenyl)-4-oxo-3,5-dihydro-2H-1,5-benzothiazepin-3-yl] methanesulfonate.
Molecular Properties
| Compound Name | [2-(4-methoxyphenyl)-4-oxo-3,5-dihydro-2H-1,5-benzothiazepin-3-yl] methanesulfonate |
| PubChem CID | 19022662 |
| Molecular Formula | C17H17NO5S2 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.05 |
| IUPAC Name | [2-(4-methoxyphenyl)-4-oxo-3,5-dihydro-2H-1,5-benzothiazepin-3-yl] methanesulfonate |
| SMILES | COc1ccc(C2Sc3ccccc3NC(=O)C2OS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C17H17NO5S2/c1-22-12-9-7-11(8-10-12)16-15(23-25(2,20)21)17(19)18-13-5-3-4-6-14(13)24-16/h3-10,15-16H,1-2H3,(H,18,19) |
| InChIKey | OIMYKYPTUMSGKJ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [2-(4-methoxyphenyl)-4-oxo-3,5-dihydro-2H-1,5-benzothiazepin-3-yl] methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(4-methoxyphenyl)-4-oxo-3,5-dihydro-2H-1,5-benzothiazepin-3-yl] methanesulfonate?
The IUPAC name of [2-(4-methoxyphenyl)-4-oxo-3,5-dihydro-2H-1,5-benzothiazepin-3-yl] methanesulfonate (CID 19022662) is [2-(4-methoxyphenyl)-4-oxo-3,5-dihydro-2H-1,5-benzothiazepin-3-yl] methanesulfonate.
What is the SMILES notation for [2-(4-methoxyphenyl)-4-oxo-3,5-dihydro-2H-1,5-benzothiazepin-3-yl] methanesulfonate?
The canonical SMILES for [2-(4-methoxyphenyl)-4-oxo-3,5-dihydro-2H-1,5-benzothiazepin-3-yl] methanesulfonate is COc1ccc(C2Sc3ccccc3NC(=O)C2OS(C)(=O)=O)cc1.
What is the InChIKey of [2-(4-methoxyphenyl)-4-oxo-3,5-dihydro-2H-1,5-benzothiazepin-3-yl] methanesulfonate?
The InChIKey is OIMYKYPTUMSGKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17NO5S2/c1-22-12-9-7-11(8-10-12)16-15(23-25(2,20)21)17(19)18-13-5-3-4-6-14(13)24-16/h3-10,15-16H,1-2H3,(H,18,19).
What are the key properties of [2-(4-methoxyphenyl)-4-oxo-3,5-dihydro-2H-1,5-benzothiazepin-3-yl] methanesulfonate?
[2-(4-methoxyphenyl)-4-oxo-3,5-dihydro-2H-1,5-benzothiazepin-3-yl] methanesulfonate has a molecular weight of 379.46 g/mol, XLogP of 2.83, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(4-methoxyphenyl)-4-oxo-3,5-dihydro-2H-1,5-benzothiazepin-3-yl] methanesulfonate is sourced from PubChem (CID 19022662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).