C26H33NO4 — CID 19023992
[2-[butyl(phenyl)carbamoyl]-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-yl] acetate (PubChem CID 19023992) has the molecular formula C26H33NO4 and a molecular weight of 423.55 g/mol. Its IUPAC name is [2-[butyl(phenyl)carbamoyl]-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-yl] acetate.
| Compound Name | [2-[butyl(phenyl)carbamoyl]-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-yl] acetate |
|---|---|
| PubChem CID | 19023992 |
| Molecular Formula | C26H33NO4 |
| Molecular Weight | 423.55 g/mol |
| Exact Mass | 423.24 |
| IUPAC Name | [2-[butyl(phenyl)carbamoyl]-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-yl] acetate |
| SMILES | CCCCN(C(=O)C1(C)CCc2c(C)c(OC(C)=O)c(C)c(C)c2O1)c1ccccc1 |
| InChI | InChI=1S/C26H33NO4/c1-7-8-16-27(21-12-10-9-11-13-21)25(29)26(6)15-14-22-19(4)23(30-20(5)28)17(2)18(3)24(22)31-26/h9-13H,7-8,14-16H2,1-6H3 |
| InChIKey | KPEQWVREKKBKSO-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.55 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|