C25H32N2O5 — CID 19024057
ethyl 2-[[2-[(4,6-dimethyl-2-pyridinyl)carbamoyl]-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-yl]oxy]acetate (PubChem CID 19024057) has the molecular formula C25H32N2O5 and a molecular weight of 440.54 g/mol. Its IUPAC name is ethyl 2-[[2-[(4,6-dimethyl-2-pyridinyl)carbamoyl]-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-yl]oxy]acetate.
| Compound Name | ethyl 2-[[2-[(4,6-dimethyl-2-pyridinyl)carbamoyl]-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-yl]oxy]acetate |
|---|---|
| PubChem CID | 19024057 |
| Molecular Formula | C25H32N2O5 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.23 |
| IUPAC Name | ethyl 2-[[2-[(4,6-dimethyl-2-pyridinyl)carbamoyl]-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-yl]oxy]acetate |
| SMILES | CCOC(=O)COc1c(C)c(C)c2c(c1C)CCC(C)(C(=O)Nc1cc(C)cc(C)n1)O2 |
| InChI | InChI=1S/C25H32N2O5/c1-8-30-21(28)13-31-22-16(4)17(5)23-19(18(22)6)9-10-25(7,32-23)24(29)27-20-12-14(2)11-15(3)26-20/h11-12H,8-10,13H2,1-7H3,(H,26,27,29) |
| InChIKey | IKIGNSHSBGSJOE-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |