C25H26N2O4 — CID 19024111
[5,7,8-trimethyl-2-[(4-methylquinolin-2-yl)carbamoyl]-3,4-dihydro-2H-chromen-6-yl] acetate (PubChem CID 19024111) has the molecular formula C25H26N2O4 and a molecular weight of 418.49 g/mol. Its IUPAC name is [5,7,8-trimethyl-2-[(4-methylquinolin-2-yl)carbamoyl]-3,4-dihydro-2H-chromen-6-yl] acetate.
| Compound Name | [5,7,8-trimethyl-2-[(4-methylquinolin-2-yl)carbamoyl]-3,4-dihydro-2H-chromen-6-yl] acetate |
|---|---|
| PubChem CID | 19024111 |
| Molecular Formula | C25H26N2O4 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | [5,7,8-trimethyl-2-[(4-methylquinolin-2-yl)carbamoyl]-3,4-dihydro-2H-chromen-6-yl] acetate |
| SMILES | CC(=O)Oc1c(C)c(C)c2c(c1C)CCC(C(=O)Nc1cc(C)c3ccccc3n1)O2 |
| InChI | InChI=1S/C25H26N2O4/c1-13-12-22(26-20-9-7-6-8-18(13)20)27-25(29)21-11-10-19-16(4)23(30-17(5)28)14(2)15(3)24(19)31-21/h6-9,12,21H,10-11H2,1-5H3,(H,26,27,29) |
| InChIKey | KPLYUTYSXXHUSG-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|