C17H9F7N2O4S — CID 19024248
2-[4-(1,1,2,2,3,3,3-heptafluoropropylsulfonyl)anilino]isoindole-1,3-dione (PubChem CID 19024248) has the molecular formula C17H9F7N2O4S and a molecular weight of 470.32 g/mol. Its IUPAC name is 2-[4-(1,1,2,2,3,3,3-heptafluoropropylsulfonyl)anilino]isoindole-1,3-dione.
| Compound Name | 2-[4-(1,1,2,2,3,3,3-heptafluoropropylsulfonyl)anilino]isoindole-1,3-dione |
|---|---|
| PubChem CID | 19024248 |
| Molecular Formula | C17H9F7N2O4S |
| Molecular Weight | 470.32 g/mol |
| Exact Mass | 470.02 |
| IUPAC Name | 2-[4-(1,1,2,2,3,3,3-heptafluoropropylsulfonyl)anilino]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1Nc1ccc(S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H9F7N2O4S/c18-15(19,16(20,21)22)17(23,24)31(29,30)10-7-5-9(6-8-10)25-26-13(27)11-3-1-2-4-12(11)14(26)28/h1-8,25H |
| InChIKey | QQKDPIFOFINTML-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.32 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|