C42H51F3O5 — CID 19025179
2-decoxynaphthalene;4-[4-(1,1,1-trifluorooctan-2-yloxycarbonyl)phenyl]benzoic acid (PubChem CID 19025179) has the molecular formula C42H51F3O5 and a molecular weight of 692.86 g/mol. Its IUPAC name is 2-decoxynaphthalene;4-[4-(1,1,1-trifluorooctan-2-yloxycarbonyl)phenyl]benzoic acid.
| Compound Name | 2-decoxynaphthalene;4-[4-(1,1,1-trifluorooctan-2-yloxycarbonyl)phenyl]benzoic acid |
|---|---|
| PubChem CID | 19025179 |
| Molecular Formula | C42H51F3O5 |
| Molecular Weight | 692.86 g/mol |
| Exact Mass | 692.37 |
| IUPAC Name | 2-decoxynaphthalene;4-[4-(1,1,1-trifluorooctan-2-yloxycarbonyl)phenyl]benzoic acid |
| SMILES | CCCCCCC(OC(=O)c1ccc(-c2ccc(C(=O)O)cc2)cc1)C(F)(F)F.CCCCCCCCCCOc1ccc2ccccc2c1 |
| InChI | InChI=1S/C22H23F3O4.C20H28O/c1-2-3-4-5-6-19(22(23,24)25)29-21(28)18-13-9-16(10-14-18)15-7-11-17(12-8-15)20(26)27;1-2-3-4-5-6-7-8-11-16-21-20-15-14-18-12-9-10-13-19(18)17-20/h7-14,19H,2-6H2,1H3,(H,26,27);9-10,12-15,17H,2-8,11,16H2,1H3 |
| InChIKey | AZHQLDNPDSDQLZ-UHFFFAOYSA-N |
| XLogP | 12.47 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.86 |
| LogP ≤ 5 | 12.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|