About acetonitrile;4-chloro-7-(3-methylbutoxy)-2,3-dihydro-1H-isoindole
acetonitrile;4-chloro-7-(3-methylbutoxy)-2,3-dihydro-1H-isoindole (PubChem CID 19025824) has the molecular formula C15H21ClN2O
and a molecular weight of 280.80 g/mol. Its IUPAC name is acetonitrile;4-chloro-7-(3-methylbutoxy)-2,3-dihydro-1H-isoindole.
Molecular Properties
| Compound Name | acetonitrile;4-chloro-7-(3-methylbutoxy)-2,3-dihydro-1H-isoindole |
| PubChem CID | 19025824 |
| Molecular Formula | C15H21ClN2O |
| Molecular Weight | 280.80 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | acetonitrile;4-chloro-7-(3-methylbutoxy)-2,3-dihydro-1H-isoindole |
| SMILES | CC#N.CC(C)CCOc1ccc(Cl)c2c1CNC2 |
| InChI | InChI=1S/C13H18ClNO.C2H3N/c1-9(2)5-6-16-13-4-3-12(14)10-7-15-8-11(10)13;1-2-3/h3-4,9,15H,5-8H2,1-2H3;1H3 |
| InChIKey | MGDGPJHFQDRYLQ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.80 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze acetonitrile;4-chloro-7-(3-methylbutoxy)-2,3-dihydro-1H-isoindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetonitrile;4-chloro-7-(3-methylbutoxy)-2,3-dihydro-1H-isoindole?
The IUPAC name of acetonitrile;4-chloro-7-(3-methylbutoxy)-2,3-dihydro-1H-isoindole (CID 19025824) is acetonitrile;4-chloro-7-(3-methylbutoxy)-2,3-dihydro-1H-isoindole.
What is the SMILES notation for acetonitrile;4-chloro-7-(3-methylbutoxy)-2,3-dihydro-1H-isoindole?
The canonical SMILES for acetonitrile;4-chloro-7-(3-methylbutoxy)-2,3-dihydro-1H-isoindole is CC#N.CC(C)CCOc1ccc(Cl)c2c1CNC2.
What is the InChIKey of acetonitrile;4-chloro-7-(3-methylbutoxy)-2,3-dihydro-1H-isoindole?
The InChIKey is MGDGPJHFQDRYLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18ClNO.C2H3N/c1-9(2)5-6-16-13-4-3-12(14)10-7-15-8-11(10)13;1-2-3/h3-4,9,15H,5-8H2,1-2H3;1H3.
What are the key properties of acetonitrile;4-chloro-7-(3-methylbutoxy)-2,3-dihydro-1H-isoindole?
acetonitrile;4-chloro-7-(3-methylbutoxy)-2,3-dihydro-1H-isoindole has a molecular weight of 280.80 g/mol, XLogP of 3.90, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetonitrile;4-chloro-7-(3-methylbutoxy)-2,3-dihydro-1H-isoindole is sourced from PubChem (CID 19025824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).