C22H30Cl2O3 — CID 19025876
(3,3,5-trimethylcyclohexyl) 2-[4-(2,2-dichlorocyclopropyl)phenoxy]-2-methylpropanoate (PubChem CID 19025876) has the molecular formula C22H30Cl2O3 and a molecular weight of 413.39 g/mol. Its IUPAC name is (3,3,5-trimethylcyclohexyl) 2-[4-(2,2-dichlorocyclopropyl)phenoxy]-2-methylpropanoate.
| Compound Name | (3,3,5-trimethylcyclohexyl) 2-[4-(2,2-dichlorocyclopropyl)phenoxy]-2-methylpropanoate |
|---|---|
| PubChem CID | 19025876 |
| Molecular Formula | C22H30Cl2O3 |
| Molecular Weight | 413.39 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | (3,3,5-trimethylcyclohexyl) 2-[4-(2,2-dichlorocyclopropyl)phenoxy]-2-methylpropanoate |
| SMILES | CC1CC(OC(=O)C(C)(C)Oc2ccc(C3CC3(Cl)Cl)cc2)CC(C)(C)C1 |
| InChI | InChI=1S/C22H30Cl2O3/c1-14-10-17(12-20(2,3)11-14)26-19(25)21(4,5)27-16-8-6-15(7-9-16)18-13-22(18,23)24/h6-9,14,17-18H,10-13H2,1-5H3 |
| InChIKey | SMKLHVCEZZCRAK-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.39 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|