C6H6F8N2 — CID 19025989
2,2,3,3,5,5,6,6-octafluoro-1,4-dimethylpiperazine (PubChem CID 19025989) has the molecular formula C6H6F8N2 and a molecular weight of 258.11 g/mol. Its IUPAC name is 2,2,3,3,5,5,6,6-octafluoro-1,4-dimethylpiperazine.
| Compound Name | 2,2,3,3,5,5,6,6-octafluoro-1,4-dimethylpiperazine |
|---|---|
| PubChem CID | 19025989 |
| Molecular Formula | C6H6F8N2 |
| Molecular Weight | 258.11 g/mol |
| Exact Mass | 258.04 |
| IUPAC Name | 2,2,3,3,5,5,6,6-octafluoro-1,4-dimethylpiperazine |
| SMILES | CN1C(F)(F)C(F)(F)N(C)C(F)(F)C1(F)F |
| InChI | InChI=1S/C6H6F8N2/c1-15-3(7,8)5(11,12)16(2)6(13,14)4(15,9)10/h1-2H3 |
| InChIKey | NGWWLHOHNLYRKK-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.11 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|