C5H10O4P2 — CID 19026043
2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane (PubChem CID 19026043) has the molecular formula C5H10O4P2 and a molecular weight of 196.08 g/mol. Its IUPAC name is 2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane.
| Compound Name | 2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane |
|---|---|
| PubChem CID | 19026043 |
| Molecular Formula | C5H10O4P2 |
| Molecular Weight | 196.08 g/mol |
| Exact Mass | 196.01 |
| IUPAC Name | 2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane |
| SMILES | C1OPOCC12COPOC2 |
| InChI | InChI=1S/C5H10O4P2/c1-5(2-7-10-6-1)3-8-11-9-4-5/h10-11H,1-4H2 |
| InChIKey | JWOWIZVDYKUULJ-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.08 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|