C25H27ClN2O3 — CID 19026199
N-phenylmethoxy-N-(2-phenylmethoxy-5,6,7,8-tetrahydroquinolin-5-yl)acetamide;hydrochloride (PubChem CID 19026199) has the molecular formula C25H27ClN2O3 and a molecular weight of 438.96 g/mol. Its IUPAC name is N-phenylmethoxy-N-(2-phenylmethoxy-5,6,7,8-tetrahydroquinolin-5-yl)acetamide;hydrochloride.
| Compound Name | N-phenylmethoxy-N-(2-phenylmethoxy-5,6,7,8-tetrahydroquinolin-5-yl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 19026199 |
| Molecular Formula | C25H27ClN2O3 |
| Molecular Weight | 438.96 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | N-phenylmethoxy-N-(2-phenylmethoxy-5,6,7,8-tetrahydroquinolin-5-yl)acetamide;hydrochloride |
| SMILES | CC(=O)N(OCc1ccccc1)C1CCCc2nc(OCc3ccccc3)ccc21.Cl |
| InChI | InChI=1S/C25H26N2O3.ClH/c1-19(28)27(30-18-21-11-6-3-7-12-21)24-14-8-13-23-22(24)15-16-25(26-23)29-17-20-9-4-2-5-10-20;/h2-7,9-12,15-16,24H,8,13-14,17-18H2,1H3;1H |
| InChIKey | UYCWQULISCAOAY-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.96 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|