About N-ethyl-N',N',2-trimethylprop-2-enehydrazide
N-ethyl-N',N',2-trimethylprop-2-enehydrazide (PubChem CID 19026482) has the molecular formula C8H16N2O
and a molecular weight of 156.23 g/mol. Its IUPAC name is N-ethyl-N',N',2-trimethylprop-2-enehydrazide.
Molecular Properties
| Compound Name | N-ethyl-N',N',2-trimethylprop-2-enehydrazide |
| PubChem CID | 19026482 |
| Molecular Formula | C8H16N2O |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.13 |
| IUPAC Name | N-ethyl-N',N',2-trimethylprop-2-enehydrazide |
| SMILES | C=C(C)C(=O)N(CC)N(C)C |
| InChI | InChI=1S/C8H16N2O/c1-6-10(9(4)5)8(11)7(2)3/h2,6H2,1,3-5H3 |
| InChIKey | RSMSNGDEGGHXOY-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-N',N',2-trimethylprop-2-enehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N',N',2-trimethylprop-2-enehydrazide?
The IUPAC name of N-ethyl-N',N',2-trimethylprop-2-enehydrazide (CID 19026482) is N-ethyl-N',N',2-trimethylprop-2-enehydrazide.
What is the SMILES notation for N-ethyl-N',N',2-trimethylprop-2-enehydrazide?
The canonical SMILES for N-ethyl-N',N',2-trimethylprop-2-enehydrazide is C=C(C)C(=O)N(CC)N(C)C.
What is the InChIKey of N-ethyl-N',N',2-trimethylprop-2-enehydrazide?
The InChIKey is RSMSNGDEGGHXOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2O/c1-6-10(9(4)5)8(11)7(2)3/h2,6H2,1,3-5H3.
What are the key properties of N-ethyl-N',N',2-trimethylprop-2-enehydrazide?
N-ethyl-N',N',2-trimethylprop-2-enehydrazide has a molecular weight of 156.23 g/mol, XLogP of 0.89, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N',N',2-trimethylprop-2-enehydrazide is sourced from PubChem (CID 19026482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).