About 1-propoxy-4-[4-(3,3,3-trifluoropropyl)cyclohexyl]cyclohexane
1-propoxy-4-[4-(3,3,3-trifluoropropyl)cyclohexyl]cyclohexane (PubChem CID 19026514) has the molecular formula C18H31F3O
and a molecular weight of 320.44 g/mol. Its IUPAC name is 1-propoxy-4-[4-(3,3,3-trifluoropropyl)cyclohexyl]cyclohexane.
Molecular Properties
| Compound Name | 1-propoxy-4-[4-(3,3,3-trifluoropropyl)cyclohexyl]cyclohexane |
| PubChem CID | 19026514 |
| Molecular Formula | C18H31F3O |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.23 |
| IUPAC Name | 1-propoxy-4-[4-(3,3,3-trifluoropropyl)cyclohexyl]cyclohexane |
| SMILES | CCCOC1CCC(C2CCC(CCC(F)(F)F)CC2)CC1 |
| InChI | InChI=1S/C18H31F3O/c1-2-13-22-17-9-7-16(8-10-17)15-5-3-14(4-6-15)11-12-18(19,20)21/h14-17H,2-13H2,1H3 |
| InChIKey | JXJHKOPHQLNXMX-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-propoxy-4-[4-(3,3,3-trifluoropropyl)cyclohexyl]cyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-propoxy-4-[4-(3,3,3-trifluoropropyl)cyclohexyl]cyclohexane?
The IUPAC name of 1-propoxy-4-[4-(3,3,3-trifluoropropyl)cyclohexyl]cyclohexane (CID 19026514) is 1-propoxy-4-[4-(3,3,3-trifluoropropyl)cyclohexyl]cyclohexane.
What is the SMILES notation for 1-propoxy-4-[4-(3,3,3-trifluoropropyl)cyclohexyl]cyclohexane?
The canonical SMILES for 1-propoxy-4-[4-(3,3,3-trifluoropropyl)cyclohexyl]cyclohexane is CCCOC1CCC(C2CCC(CCC(F)(F)F)CC2)CC1.
What is the InChIKey of 1-propoxy-4-[4-(3,3,3-trifluoropropyl)cyclohexyl]cyclohexane?
The InChIKey is JXJHKOPHQLNXMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H31F3O/c1-2-13-22-17-9-7-16(8-10-17)15-5-3-14(4-6-15)11-12-18(19,20)21/h14-17H,2-13H2,1H3.
What are the key properties of 1-propoxy-4-[4-(3,3,3-trifluoropropyl)cyclohexyl]cyclohexane?
1-propoxy-4-[4-(3,3,3-trifluoropropyl)cyclohexyl]cyclohexane has a molecular weight of 320.44 g/mol, XLogP of 6.12, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-propoxy-4-[4-(3,3,3-trifluoropropyl)cyclohexyl]cyclohexane is sourced from PubChem (CID 19026514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).