About 1-(4-butoxy-5,5,5-trifluoropentyl)-4-cyclohexylcyclohexane
1-(4-butoxy-5,5,5-trifluoropentyl)-4-cyclohexylcyclohexane (PubChem CID 19026573) has the molecular formula C21H37F3O
and a molecular weight of 362.52 g/mol. Its IUPAC name is 1-(4-butoxy-5,5,5-trifluoropentyl)-4-cyclohexylcyclohexane.
Molecular Properties
| Compound Name | 1-(4-butoxy-5,5,5-trifluoropentyl)-4-cyclohexylcyclohexane |
| PubChem CID | 19026573 |
| Molecular Formula | C21H37F3O |
| Molecular Weight | 362.52 g/mol |
| Exact Mass | 362.28 |
| IUPAC Name | 1-(4-butoxy-5,5,5-trifluoropentyl)-4-cyclohexylcyclohexane |
| SMILES | CCCCOC(CCCC1CCC(C2CCCCC2)CC1)C(F)(F)F |
| InChI | InChI=1S/C21H37F3O/c1-2-3-16-25-20(21(22,23)24)11-7-8-17-12-14-19(15-13-17)18-9-5-4-6-10-18/h17-20H,2-16H2,1H3 |
| InChIKey | UOFPGJUUKOMHPQ-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 362.52 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-butoxy-5,5,5-trifluoropentyl)-4-cyclohexylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-butoxy-5,5,5-trifluoropentyl)-4-cyclohexylcyclohexane?
The IUPAC name of 1-(4-butoxy-5,5,5-trifluoropentyl)-4-cyclohexylcyclohexane (CID 19026573) is 1-(4-butoxy-5,5,5-trifluoropentyl)-4-cyclohexylcyclohexane.
What is the SMILES notation for 1-(4-butoxy-5,5,5-trifluoropentyl)-4-cyclohexylcyclohexane?
The canonical SMILES for 1-(4-butoxy-5,5,5-trifluoropentyl)-4-cyclohexylcyclohexane is CCCCOC(CCCC1CCC(C2CCCCC2)CC1)C(F)(F)F.
What is the InChIKey of 1-(4-butoxy-5,5,5-trifluoropentyl)-4-cyclohexylcyclohexane?
The InChIKey is UOFPGJUUKOMHPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H37F3O/c1-2-3-16-25-20(21(22,23)24)11-7-8-17-12-14-19(15-13-17)18-9-5-4-6-10-18/h17-20H,2-16H2,1H3.
What are the key properties of 1-(4-butoxy-5,5,5-trifluoropentyl)-4-cyclohexylcyclohexane?
1-(4-butoxy-5,5,5-trifluoropentyl)-4-cyclohexylcyclohexane has a molecular weight of 362.52 g/mol, XLogP of 7.29, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-butoxy-5,5,5-trifluoropentyl)-4-cyclohexylcyclohexane is sourced from PubChem (CID 19026573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).