About 1-cyclohexyl-4-(5,5,5-trifluoro-4-hexoxypentyl)cyclohexane
1-cyclohexyl-4-(5,5,5-trifluoro-4-hexoxypentyl)cyclohexane (PubChem CID 19026583) has the molecular formula C23H41F3O
and a molecular weight of 390.57 g/mol. Its IUPAC name is 1-cyclohexyl-4-(5,5,5-trifluoro-4-hexoxypentyl)cyclohexane.
Molecular Properties
| Compound Name | 1-cyclohexyl-4-(5,5,5-trifluoro-4-hexoxypentyl)cyclohexane |
| PubChem CID | 19026583 |
| Molecular Formula | C23H41F3O |
| Molecular Weight | 390.57 g/mol |
| Exact Mass | 390.31 |
| IUPAC Name | 1-cyclohexyl-4-(5,5,5-trifluoro-4-hexoxypentyl)cyclohexane |
| SMILES | CCCCCCOC(CCCC1CCC(C2CCCCC2)CC1)C(F)(F)F |
| InChI | InChI=1S/C23H41F3O/c1-2-3-4-8-18-27-22(23(24,25)26)13-9-10-19-14-16-21(17-15-19)20-11-6-5-7-12-20/h19-22H,2-18H2,1H3 |
| InChIKey | BUCYGUKYTJQIMA-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 390.57 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclohexyl-4-(5,5,5-trifluoro-4-hexoxypentyl)cyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexyl-4-(5,5,5-trifluoro-4-hexoxypentyl)cyclohexane?
The IUPAC name of 1-cyclohexyl-4-(5,5,5-trifluoro-4-hexoxypentyl)cyclohexane (CID 19026583) is 1-cyclohexyl-4-(5,5,5-trifluoro-4-hexoxypentyl)cyclohexane.
What is the SMILES notation for 1-cyclohexyl-4-(5,5,5-trifluoro-4-hexoxypentyl)cyclohexane?
The canonical SMILES for 1-cyclohexyl-4-(5,5,5-trifluoro-4-hexoxypentyl)cyclohexane is CCCCCCOC(CCCC1CCC(C2CCCCC2)CC1)C(F)(F)F.
What is the InChIKey of 1-cyclohexyl-4-(5,5,5-trifluoro-4-hexoxypentyl)cyclohexane?
The InChIKey is BUCYGUKYTJQIMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H41F3O/c1-2-3-4-8-18-27-22(23(24,25)26)13-9-10-19-14-16-21(17-15-19)20-11-6-5-7-12-20/h19-22H,2-18H2,1H3.
What are the key properties of 1-cyclohexyl-4-(5,5,5-trifluoro-4-hexoxypentyl)cyclohexane?
1-cyclohexyl-4-(5,5,5-trifluoro-4-hexoxypentyl)cyclohexane has a molecular weight of 390.57 g/mol, XLogP of 8.07, 11 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexyl-4-(5,5,5-trifluoro-4-hexoxypentyl)cyclohexane is sourced from PubChem (CID 19026583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).