C16H27F3O2 — CID 19026624
2-(4-ethylcyclohexyl)-5-(4,4,4-trifluorobutyl)-1,3-dioxane (PubChem CID 19026624) has the molecular formula C16H27F3O2 and a molecular weight of 308.38 g/mol. Its IUPAC name is 2-(4-ethylcyclohexyl)-5-(4,4,4-trifluorobutyl)-1,3-dioxane.
| Compound Name | 2-(4-ethylcyclohexyl)-5-(4,4,4-trifluorobutyl)-1,3-dioxane |
|---|---|
| PubChem CID | 19026624 |
| Molecular Formula | C16H27F3O2 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | 2-(4-ethylcyclohexyl)-5-(4,4,4-trifluorobutyl)-1,3-dioxane |
| SMILES | CCC1CCC(C2OCC(CCCC(F)(F)F)CO2)CC1 |
| InChI | InChI=1S/C16H27F3O2/c1-2-12-5-7-14(8-6-12)15-20-10-13(11-21-15)4-3-9-16(17,18)19/h12-15H,2-11H2,1H3 |
| InChIKey | FKFSLRXPRFXETA-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |