C27H47F3O2 — CID 19026661
2-[4-(4-heptylcyclohexyl)cyclohexyl]-5-(4,4,4-trifluorobutyl)-1,3-dioxane (PubChem CID 19026661) has the molecular formula C27H47F3O2 and a molecular weight of 460.67 g/mol. Its IUPAC name is 2-[4-(4-heptylcyclohexyl)cyclohexyl]-5-(4,4,4-trifluorobutyl)-1,3-dioxane.
| Compound Name | 2-[4-(4-heptylcyclohexyl)cyclohexyl]-5-(4,4,4-trifluorobutyl)-1,3-dioxane |
|---|---|
| PubChem CID | 19026661 |
| Molecular Formula | C27H47F3O2 |
| Molecular Weight | 460.67 g/mol |
| Exact Mass | 460.35 |
| IUPAC Name | 2-[4-(4-heptylcyclohexyl)cyclohexyl]-5-(4,4,4-trifluorobutyl)-1,3-dioxane |
| SMILES | CCCCCCCC1CCC(C2CCC(C3OCC(CCCC(F)(F)F)CO3)CC2)CC1 |
| InChI | InChI=1S/C27H47F3O2/c1-2-3-4-5-6-8-21-10-12-23(13-11-21)24-14-16-25(17-15-24)26-31-19-22(20-32-26)9-7-18-27(28,29)30/h21-26H,2-20H2,1H3 |
| InChIKey | BIMXSGJFEJXXAL-UHFFFAOYSA-N |
| XLogP | 8.68 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.67 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|