C15H25F3O2 — CID 19026699
2-(4-methylcyclohexyl)-5-(4,4,4-trifluorobutyl)-1,3-dioxane (PubChem CID 19026699) has the molecular formula C15H25F3O2 and a molecular weight of 294.36 g/mol. Its IUPAC name is 2-(4-methylcyclohexyl)-5-(4,4,4-trifluorobutyl)-1,3-dioxane.
| Compound Name | 2-(4-methylcyclohexyl)-5-(4,4,4-trifluorobutyl)-1,3-dioxane |
|---|---|
| PubChem CID | 19026699 |
| Molecular Formula | C15H25F3O2 |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | 2-(4-methylcyclohexyl)-5-(4,4,4-trifluorobutyl)-1,3-dioxane |
| SMILES | CC1CCC(C2OCC(CCCC(F)(F)F)CO2)CC1 |
| InChI | InChI=1S/C15H25F3O2/c1-11-4-6-13(7-5-11)14-19-9-12(10-20-14)3-2-8-15(16,17)18/h11-14H,2-10H2,1H3 |
| InChIKey | ABZMYDUSTVTFPE-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |