C18H31F3O2 — CID 19026724
2-(4-butylcyclohexyl)-5-(4,4,4-trifluorobutyl)-1,3-dioxane (PubChem CID 19026724) has the molecular formula C18H31F3O2 and a molecular weight of 336.44 g/mol. Its IUPAC name is 2-(4-butylcyclohexyl)-5-(4,4,4-trifluorobutyl)-1,3-dioxane.
| Compound Name | 2-(4-butylcyclohexyl)-5-(4,4,4-trifluorobutyl)-1,3-dioxane |
|---|---|
| PubChem CID | 19026724 |
| Molecular Formula | C18H31F3O2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | 2-(4-butylcyclohexyl)-5-(4,4,4-trifluorobutyl)-1,3-dioxane |
| SMILES | CCCCC1CCC(C2OCC(CCCC(F)(F)F)CO2)CC1 |
| InChI | InChI=1S/C18H31F3O2/c1-2-3-5-14-7-9-16(10-8-14)17-22-12-15(13-23-17)6-4-11-18(19,20)21/h14-17H,2-13H2,1H3 |
| InChIKey | CGCGWFKQZPIBKC-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |