About 4-(4-oxo-2H-1,3-benzoxazin-3-yl)butyl methanesulfonate
4-(4-oxo-2H-1,3-benzoxazin-3-yl)butyl methanesulfonate (PubChem CID 19027043) has the molecular formula C13H17NO5S
and a molecular weight of 299.35 g/mol. Its IUPAC name is 4-(4-oxo-2H-1,3-benzoxazin-3-yl)butyl methanesulfonate.
Molecular Properties
| Compound Name | 4-(4-oxo-2H-1,3-benzoxazin-3-yl)butyl methanesulfonate |
| PubChem CID | 19027043 |
| Molecular Formula | C13H17NO5S |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | 4-(4-oxo-2H-1,3-benzoxazin-3-yl)butyl methanesulfonate |
| SMILES | CS(=O)(=O)OCCCCN1COc2ccccc2C1=O |
| InChI | InChI=1S/C13H17NO5S/c1-20(16,17)19-9-5-4-8-14-10-18-12-7-3-2-6-11(12)13(14)15/h2-3,6-7H,4-5,8-10H2,1H3 |
| InChIKey | GWEOFDIYFKZSRI-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-oxo-2H-1,3-benzoxazin-3-yl)butyl methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-oxo-2H-1,3-benzoxazin-3-yl)butyl methanesulfonate?
The IUPAC name of 4-(4-oxo-2H-1,3-benzoxazin-3-yl)butyl methanesulfonate (CID 19027043) is 4-(4-oxo-2H-1,3-benzoxazin-3-yl)butyl methanesulfonate.
What is the SMILES notation for 4-(4-oxo-2H-1,3-benzoxazin-3-yl)butyl methanesulfonate?
The canonical SMILES for 4-(4-oxo-2H-1,3-benzoxazin-3-yl)butyl methanesulfonate is CS(=O)(=O)OCCCCN1COc2ccccc2C1=O.
What is the InChIKey of 4-(4-oxo-2H-1,3-benzoxazin-3-yl)butyl methanesulfonate?
The InChIKey is GWEOFDIYFKZSRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO5S/c1-20(16,17)19-9-5-4-8-14-10-18-12-7-3-2-6-11(12)13(14)15/h2-3,6-7H,4-5,8-10H2,1H3.
What are the key properties of 4-(4-oxo-2H-1,3-benzoxazin-3-yl)butyl methanesulfonate?
4-(4-oxo-2H-1,3-benzoxazin-3-yl)butyl methanesulfonate has a molecular weight of 299.35 g/mol, XLogP of 1.24, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-oxo-2H-1,3-benzoxazin-3-yl)butyl methanesulfonate is sourced from PubChem (CID 19027043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).