About (1-benzoylsulfanyl-2,5-dioxopyrrolidin-3-yl) acetate
(1-benzoylsulfanyl-2,5-dioxopyrrolidin-3-yl) acetate (PubChem CID 19027349) has the molecular formula C13H11NO5S
and a molecular weight of 293.30 g/mol. Its IUPAC name is (1-benzoylsulfanyl-2,5-dioxopyrrolidin-3-yl) acetate.
Molecular Properties
| Compound Name | (1-benzoylsulfanyl-2,5-dioxopyrrolidin-3-yl) acetate |
| PubChem CID | 19027349 |
| Molecular Formula | C13H11NO5S |
| Molecular Weight | 293.30 g/mol |
| Exact Mass | 293.04 |
| IUPAC Name | (1-benzoylsulfanyl-2,5-dioxopyrrolidin-3-yl) acetate |
| SMILES | CC(=O)OC1CC(=O)N(SC(=O)c2ccccc2)C1=O |
| InChI | InChI=1S/C13H11NO5S/c1-8(15)19-10-7-11(16)14(12(10)17)20-13(18)9-5-3-2-4-6-9/h2-6,10H,7H2,1H3 |
| InChIKey | BXRSLVAIXNZBOB-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.30 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze (1-benzoylsulfanyl-2,5-dioxopyrrolidin-3-yl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-benzoylsulfanyl-2,5-dioxopyrrolidin-3-yl) acetate?
The IUPAC name of (1-benzoylsulfanyl-2,5-dioxopyrrolidin-3-yl) acetate (CID 19027349) is (1-benzoylsulfanyl-2,5-dioxopyrrolidin-3-yl) acetate.
What is the SMILES notation for (1-benzoylsulfanyl-2,5-dioxopyrrolidin-3-yl) acetate?
The canonical SMILES for (1-benzoylsulfanyl-2,5-dioxopyrrolidin-3-yl) acetate is CC(=O)OC1CC(=O)N(SC(=O)c2ccccc2)C1=O.
What is the InChIKey of (1-benzoylsulfanyl-2,5-dioxopyrrolidin-3-yl) acetate?
The InChIKey is BXRSLVAIXNZBOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11NO5S/c1-8(15)19-10-7-11(16)14(12(10)17)20-13(18)9-5-3-2-4-6-9/h2-6,10H,7H2,1H3.
What are the key properties of (1-benzoylsulfanyl-2,5-dioxopyrrolidin-3-yl) acetate?
(1-benzoylsulfanyl-2,5-dioxopyrrolidin-3-yl) acetate has a molecular weight of 293.30 g/mol, XLogP of 1.17, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (1-benzoylsulfanyl-2,5-dioxopyrrolidin-3-yl) acetate is sourced from PubChem (CID 19027349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).