About methyl formate;propan-2-amine
methyl formate;propan-2-amine (PubChem CID 19028510) has the molecular formula C5H13NO2
and a molecular weight of 119.16 g/mol. Its IUPAC name is methyl formate;propan-2-amine.
Molecular Properties
| Compound Name | methyl formate;propan-2-amine |
| PubChem CID | 19028510 |
| Molecular Formula | C5H13NO2 |
| Molecular Weight | 119.16 g/mol |
| Exact Mass | 119.09 |
| IUPAC Name | methyl formate;propan-2-amine |
| SMILES | CC(C)N.COC=O |
| InChI | InChI=1S/C3H9N.C2H4O2/c1-3(2)4;1-4-2-3/h3H,4H2,1-2H3;2H,1H3 |
| InChIKey | XHHCNODABGQRTF-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 119.16 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze methyl formate;propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl formate;propan-2-amine?
The IUPAC name of methyl formate;propan-2-amine (CID 19028510) is methyl formate;propan-2-amine.
What is the SMILES notation for methyl formate;propan-2-amine?
The canonical SMILES for methyl formate;propan-2-amine is CC(C)N.COC=O.
What is the InChIKey of methyl formate;propan-2-amine?
The InChIKey is XHHCNODABGQRTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9N.C2H4O2/c1-3(2)4;1-4-2-3/h3H,4H2,1-2H3;2H,1H3.
What are the key properties of methyl formate;propan-2-amine?
methyl formate;propan-2-amine has a molecular weight of 119.16 g/mol, XLogP of 0.14, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl formate;propan-2-amine is sourced from PubChem (CID 19028510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).