About 5-methoxyspiro[2,4-dihydro-1H-naphthalene-3,2'-piperidine];hydrochloride
5-methoxyspiro[2,4-dihydro-1H-naphthalene-3,2'-piperidine];hydrochloride (PubChem CID 19028933) has the molecular formula C15H22ClNO
and a molecular weight of 267.80 g/mol. Its IUPAC name is 5-methoxyspiro[2,4-dihydro-1H-naphthalene-3,2'-piperidine];hydrochloride.
Molecular Properties
| Compound Name | 5-methoxyspiro[2,4-dihydro-1H-naphthalene-3,2'-piperidine];hydrochloride |
| PubChem CID | 19028933 |
| Molecular Formula | C15H22ClNO |
| Molecular Weight | 267.80 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | 5-methoxyspiro[2,4-dihydro-1H-naphthalene-3,2'-piperidine];hydrochloride |
| SMILES | COc1cccc2c1CC1(CCCCN1)CC2.Cl |
| InChI | InChI=1S/C15H21NO.ClH/c1-17-14-6-4-5-12-7-9-15(11-13(12)14)8-2-3-10-16-15;/h4-6,16H,2-3,7-11H2,1H3;1H |
| InChIKey | AJMDXPBKCMCUGZ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.80 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-methoxyspiro[2,4-dihydro-1H-naphthalene-3,2'-piperidine];hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxyspiro[2,4-dihydro-1H-naphthalene-3,2'-piperidine];hydrochloride?
The IUPAC name of 5-methoxyspiro[2,4-dihydro-1H-naphthalene-3,2'-piperidine];hydrochloride (CID 19028933) is 5-methoxyspiro[2,4-dihydro-1H-naphthalene-3,2'-piperidine];hydrochloride.
What is the SMILES notation for 5-methoxyspiro[2,4-dihydro-1H-naphthalene-3,2'-piperidine];hydrochloride?
The canonical SMILES for 5-methoxyspiro[2,4-dihydro-1H-naphthalene-3,2'-piperidine];hydrochloride is COc1cccc2c1CC1(CCCCN1)CC2.Cl.
What is the InChIKey of 5-methoxyspiro[2,4-dihydro-1H-naphthalene-3,2'-piperidine];hydrochloride?
The InChIKey is AJMDXPBKCMCUGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21NO.ClH/c1-17-14-6-4-5-12-7-9-15(11-13(12)14)8-2-3-10-16-15;/h4-6,16H,2-3,7-11H2,1H3;1H.
What are the key properties of 5-methoxyspiro[2,4-dihydro-1H-naphthalene-3,2'-piperidine];hydrochloride?
5-methoxyspiro[2,4-dihydro-1H-naphthalene-3,2'-piperidine];hydrochloride has a molecular weight of 267.80 g/mol, XLogP of 3.12, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxyspiro[2,4-dihydro-1H-naphthalene-3,2'-piperidine];hydrochloride is sourced from PubChem (CID 19028933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).