About 5-hydroxy-N-methyl-N,3-diphenylpentanamide
5-hydroxy-N-methyl-N,3-diphenylpentanamide (PubChem CID 19029331) has the molecular formula C18H21NO2
and a molecular weight of 283.37 g/mol. Its IUPAC name is 5-hydroxy-N-methyl-N,3-diphenylpentanamide.
Molecular Properties
| Compound Name | 5-hydroxy-N-methyl-N,3-diphenylpentanamide |
| PubChem CID | 19029331 |
| Molecular Formula | C18H21NO2 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | 5-hydroxy-N-methyl-N,3-diphenylpentanamide |
| SMILES | CN(C(=O)CC(CCO)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H21NO2/c1-19(17-10-6-3-7-11-17)18(21)14-16(12-13-20)15-8-4-2-5-9-15/h2-11,16,20H,12-14H2,1H3 |
| InChIKey | KTNHBCCZIGBLFF-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-hydroxy-N-methyl-N,3-diphenylpentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hydroxy-N-methyl-N,3-diphenylpentanamide?
The IUPAC name of 5-hydroxy-N-methyl-N,3-diphenylpentanamide (CID 19029331) is 5-hydroxy-N-methyl-N,3-diphenylpentanamide.
What is the SMILES notation for 5-hydroxy-N-methyl-N,3-diphenylpentanamide?
The canonical SMILES for 5-hydroxy-N-methyl-N,3-diphenylpentanamide is CN(C(=O)CC(CCO)c1ccccc1)c1ccccc1.
What is the InChIKey of 5-hydroxy-N-methyl-N,3-diphenylpentanamide?
The InChIKey is KTNHBCCZIGBLFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21NO2/c1-19(17-10-6-3-7-11-17)18(21)14-16(12-13-20)15-8-4-2-5-9-15/h2-11,16,20H,12-14H2,1H3.
What are the key properties of 5-hydroxy-N-methyl-N,3-diphenylpentanamide?
5-hydroxy-N-methyl-N,3-diphenylpentanamide has a molecular weight of 283.37 g/mol, XLogP of 3.21, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxy-N-methyl-N,3-diphenylpentanamide is sourced from PubChem (CID 19029331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).