About N-(5-ethyl-1,3-thiazol-2-yl)cyclopropanecarboxamide
N-(5-ethyl-1,3-thiazol-2-yl)cyclopropanecarboxamide (PubChem CID 19029639) has the molecular formula C9H12N2OS
and a molecular weight of 196.27 g/mol. Its IUPAC name is N-(5-ethyl-1,3-thiazol-2-yl)cyclopropanecarboxamide.
Molecular Properties
| Compound Name | N-(5-ethyl-1,3-thiazol-2-yl)cyclopropanecarboxamide |
| PubChem CID | 19029639 |
| Molecular Formula | C9H12N2OS |
| Molecular Weight | 196.27 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | N-(5-ethyl-1,3-thiazol-2-yl)cyclopropanecarboxamide |
| SMILES | CCc1cnc(NC(=O)C2CC2)s1 |
| InChI | InChI=1S/C9H12N2OS/c1-2-7-5-10-9(13-7)11-8(12)6-3-4-6/h5-6H,2-4H2,1H3,(H,10,11,12) |
| InChIKey | WTWNVGGDWJNNBK-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.27 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(5-ethyl-1,3-thiazol-2-yl)cyclopropanecarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-ethyl-1,3-thiazol-2-yl)cyclopropanecarboxamide?
The IUPAC name of N-(5-ethyl-1,3-thiazol-2-yl)cyclopropanecarboxamide (CID 19029639) is N-(5-ethyl-1,3-thiazol-2-yl)cyclopropanecarboxamide.
What is the SMILES notation for N-(5-ethyl-1,3-thiazol-2-yl)cyclopropanecarboxamide?
The canonical SMILES for N-(5-ethyl-1,3-thiazol-2-yl)cyclopropanecarboxamide is CCc1cnc(NC(=O)C2CC2)s1.
What is the InChIKey of N-(5-ethyl-1,3-thiazol-2-yl)cyclopropanecarboxamide?
The InChIKey is WTWNVGGDWJNNBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2OS/c1-2-7-5-10-9(13-7)11-8(12)6-3-4-6/h5-6H,2-4H2,1H3,(H,10,11,12).
What are the key properties of N-(5-ethyl-1,3-thiazol-2-yl)cyclopropanecarboxamide?
N-(5-ethyl-1,3-thiazol-2-yl)cyclopropanecarboxamide has a molecular weight of 196.27 g/mol, XLogP of 2.05, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-ethyl-1,3-thiazol-2-yl)cyclopropanecarboxamide is sourced from PubChem (CID 19029639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).