C22H34O3 — CID 19029827
(5,8-dimethoxy-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl)methanol (PubChem CID 19029827) has the molecular formula C22H34O3 and a molecular weight of 346.51 g/mol. Its IUPAC name is (5,8-dimethoxy-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl)methanol.
| Compound Name | (5,8-dimethoxy-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl)methanol |
|---|---|
| PubChem CID | 19029827 |
| Molecular Formula | C22H34O3 |
| Molecular Weight | 346.51 g/mol |
| Exact Mass | 346.25 |
| IUPAC Name | (5,8-dimethoxy-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl)methanol |
| SMILES | COc1cc(C(C)C)c(OC)c2c1C1(C)CCCC(C)(CO)C1CC2 |
| InChI | InChI=1S/C22H34O3/c1-14(2)16-12-17(24-5)19-15(20(16)25-6)8-9-18-21(3,13-23)10-7-11-22(18,19)4/h12,14,18,23H,7-11,13H2,1-6H3 |
| InChIKey | MIWGYPRZTYTKBG-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.51 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |