About 3-(1,4-dioxaspiro[4.5]decan-3-ylmethoxymethyl)-1,4-dioxaspiro[4.5]decane
3-(1,4-dioxaspiro[4.5]decan-3-ylmethoxymethyl)-1,4-dioxaspiro[4.5]decane (PubChem CID 19030177) has the molecular formula C18H30O5
and a molecular weight of 326.43 g/mol. Its IUPAC name is 3-(1,4-dioxaspiro[4.5]decan-3-ylmethoxymethyl)-1,4-dioxaspiro[4.5]decane.
Molecular Properties
| Compound Name | 3-(1,4-dioxaspiro[4.5]decan-3-ylmethoxymethyl)-1,4-dioxaspiro[4.5]decane |
| PubChem CID | 19030177 |
| Molecular Formula | C18H30O5 |
| Molecular Weight | 326.43 g/mol |
| Exact Mass | 326.21 |
| IUPAC Name | 3-(1,4-dioxaspiro[4.5]decan-3-ylmethoxymethyl)-1,4-dioxaspiro[4.5]decane |
| SMILES | C1CCC2(CC1)OCC(COCC1COC3(CCCCC3)O1)O2 |
| InChI | InChI=1S/C18H30O5/c1-3-7-17(8-4-1)20-13-15(22-17)11-19-12-16-14-21-18(23-16)9-5-2-6-10-18/h15-16H,1-14H2 |
| InChIKey | YGVCCFHXEIHOJE-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.43 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(1,4-dioxaspiro[4.5]decan-3-ylmethoxymethyl)-1,4-dioxaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,4-dioxaspiro[4.5]decan-3-ylmethoxymethyl)-1,4-dioxaspiro[4.5]decane?
The IUPAC name of 3-(1,4-dioxaspiro[4.5]decan-3-ylmethoxymethyl)-1,4-dioxaspiro[4.5]decane (CID 19030177) is 3-(1,4-dioxaspiro[4.5]decan-3-ylmethoxymethyl)-1,4-dioxaspiro[4.5]decane.
What is the SMILES notation for 3-(1,4-dioxaspiro[4.5]decan-3-ylmethoxymethyl)-1,4-dioxaspiro[4.5]decane?
The canonical SMILES for 3-(1,4-dioxaspiro[4.5]decan-3-ylmethoxymethyl)-1,4-dioxaspiro[4.5]decane is C1CCC2(CC1)OCC(COCC1COC3(CCCCC3)O1)O2.
What is the InChIKey of 3-(1,4-dioxaspiro[4.5]decan-3-ylmethoxymethyl)-1,4-dioxaspiro[4.5]decane?
The InChIKey is YGVCCFHXEIHOJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H30O5/c1-3-7-17(8-4-1)20-13-15(22-17)11-19-12-16-14-21-18(23-16)9-5-2-6-10-18/h15-16H,1-14H2.
What are the key properties of 3-(1,4-dioxaspiro[4.5]decan-3-ylmethoxymethyl)-1,4-dioxaspiro[4.5]decane?
3-(1,4-dioxaspiro[4.5]decan-3-ylmethoxymethyl)-1,4-dioxaspiro[4.5]decane has a molecular weight of 326.43 g/mol, XLogP of 3.15, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,4-dioxaspiro[4.5]decan-3-ylmethoxymethyl)-1,4-dioxaspiro[4.5]decane is sourced from PubChem (CID 19030177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).