C26H25N3O2 — CID 19030874
1-[4-(4-benzoylpiperazin-1-yl)phenyl]-3,4-dihydroquinolin-2-one (PubChem CID 19030874) has the molecular formula C26H25N3O2 and a molecular weight of 411.51 g/mol. Its IUPAC name is 1-[4-(4-benzoylpiperazin-1-yl)phenyl]-3,4-dihydroquinolin-2-one.
| Compound Name | 1-[4-(4-benzoylpiperazin-1-yl)phenyl]-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 19030874 |
| Molecular Formula | C26H25N3O2 |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.19 |
| IUPAC Name | 1-[4-(4-benzoylpiperazin-1-yl)phenyl]-3,4-dihydroquinolin-2-one |
| SMILES | O=C(c1ccccc1)N1CCN(c2ccc(N3C(=O)CCc4ccccc43)cc2)CC1 |
| InChI | InChI=1S/C26H25N3O2/c30-25-15-10-20-6-4-5-9-24(20)29(25)23-13-11-22(12-14-23)27-16-18-28(19-17-27)26(31)21-7-2-1-3-8-21/h1-9,11-14H,10,15-19H2 |
| InChIKey | MWWCFUILYBYCJU-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|